C14H11BO5 — CID 25010450
4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoic acid (PubChem CID 25010450) has the molecular formula C14H11BO5 and a molecular weight of 270.05 g/mol. Its IUPAC name is 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoic acid.
| Compound Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoic acid |
|---|---|
| PubChem CID | 25010450 |
| Molecular Formula | C14H11BO5 |
| Molecular Weight | 270.05 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]benzoic acid |
| SMILES | O=C(O)c1ccc(Oc2ccc3c(c2)COB3O)cc1 |
| InChI | InChI=1S/C14H11BO5/c16-14(17)9-1-3-11(4-2-9)20-12-5-6-13-10(7-12)8-19-15(13)18/h1-7,18H,8H2,(H,16,17) |
| InChIKey | BYVNFPQXJOQGEM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.05 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|