C21H23BF6N3O5P — CID 158786876
2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-isocyanophenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone hexafluorophosphate (PubChem CID 158786876) has the molecular formula C21H23BF6N3O5P and a molecular weight of 553.21 g/mol. Its IUPAC name is 2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-isocyanophenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone hexafluorophosphate.
| Compound Name | 2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-isocyanophenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone hexafluorophosphate |
|---|---|
| PubChem CID | 158786876 |
| Molecular Formula | C21H23BF6N3O5P |
| Molecular Weight | 553.21 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-isocyanophenoxy]-1-(4-methylpiperazin-4-ium-1-yl)ethanone hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[C-]#[N+]c1ccc(Oc2ccc3c(c2)COB3O)cc1OCC(=O)N1CC[NH+](C)CC1 |
| InChI | InChI=1S/C21H22BN3O5.F6P/c1-23-19-6-4-17(30-16-3-5-18-15(11-16)13-29-22(18)27)12-20(19)28-14-21(26)25-9-7-24(2)8-10-25;1-7(2,3,4,5)6/h3-6,11-12,27H,7-10,13-14H2,2H3;/q;-1/p+1 |
| InChIKey | BOLKAGOIKJDTAA-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 77.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.21 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|