C10H10BFO4 — CID 125499799
1-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one (PubChem CID 125499799) has the molecular formula C10H10BFO4 and a molecular weight of 224.00 g/mol. Its IUPAC name is 1-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one.
| Compound Name | 1-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
|---|---|
| PubChem CID | 125499799 |
| Molecular Formula | C10H10BFO4 |
| Molecular Weight | 224.00 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]propan-2-one |
| SMILES | CC(=O)COc1cc2c(cc1F)COB2O |
| InChI | InChI=1S/C10H10BFO4/c1-6(13)4-15-10-3-8-7(2-9(10)12)5-16-11(8)14/h2-3,14H,4-5H2,1H3 |
| InChIKey | NPTSXYKPHAANTG-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.00 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|