C17H13BClFN2O5 — CID 90113318
5-chloro-6-[(6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-oxobutoxy)pyridine-3-carbonitrile (PubChem CID 90113318) has the molecular formula C17H13BClFN2O5 and a molecular weight of 390.56 g/mol. Its IUPAC name is 5-chloro-6-[(6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-oxobutoxy)pyridine-3-carbonitrile.
| Compound Name | 5-chloro-6-[(6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-oxobutoxy)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 90113318 |
| Molecular Formula | C17H13BClFN2O5 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 5-chloro-6-[(6-fluoro-1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-2-(3-oxobutoxy)pyridine-3-carbonitrile |
| SMILES | CC(=O)CCOc1nc(Oc2cc3c(cc2F)B(O)OC3)c(Cl)cc1C#N |
| InChI | InChI=1S/C17H13BClFN2O5/c1-9(23)2-3-25-16-10(7-21)4-13(19)17(22-16)27-15-5-11-8-26-18(24)12(11)6-14(15)20/h4-6,24H,2-3,8H2,1H3 |
| InChIKey | STZNSDHROIACBI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|