C11H12BFN2O3 — CID 124672985
(2R)-2-amino-3-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile (PubChem CID 124672985) has the molecular formula C11H12BFN2O3 and a molecular weight of 250.04 g/mol. Its IUPAC name is (2R)-2-amino-3-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile.
| Compound Name | (2R)-2-amino-3-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 124672985 |
| Molecular Formula | C11H12BFN2O3 |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | (2R)-2-amino-3-[(5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile |
| SMILES | C[C@@](N)(C#N)COc1cc2c(cc1F)COB2O |
| InChI | InChI=1S/C11H12BFN2O3/c1-11(15,5-14)6-17-10-3-8-7(2-9(10)13)4-18-12(8)16/h2-3,16H,4,6,15H2,1H3/t11-/m1/s1 |
| InChIKey | XPCUIOISAYTNPR-LLVKDONJSA-N |
| XLogP | -0.34 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|