C11H11BClFN2O3 — CID 124672971
(2R)-2-amino-3-[(7-chloro-5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile (PubChem CID 124672971) has the molecular formula C11H11BClFN2O3 and a molecular weight of 284.48 g/mol. Its IUPAC name is (2R)-2-amino-3-[(7-chloro-5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile.
| Compound Name | (2R)-2-amino-3-[(7-chloro-5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 124672971 |
| Molecular Formula | C11H11BClFN2O3 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (2R)-2-amino-3-[(7-chloro-5-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-2-methylpropanenitrile |
| SMILES | C[C@@](N)(C#N)COc1c(F)cc2c(c1Cl)B(O)OC2 |
| InChI | InChI=1S/C11H11BClFN2O3/c1-11(16,4-15)5-18-10-7(14)2-6-3-19-12(17)8(6)9(10)13/h2,17H,3,5,16H2,1H3/t11-/m1/s1 |
| InChIKey | LWSGBUSBIWCUMH-LLVKDONJSA-N |
| XLogP | 0.32 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|