C10H12BClO3 — CID 142601937
5-chloro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborole (PubChem CID 142601937) has the molecular formula C10H12BClO3 and a molecular weight of 226.47 g/mol. Its IUPAC name is 5-chloro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborole.
| Compound Name | 5-chloro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 142601937 |
| Molecular Formula | C10H12BClO3 |
| Molecular Weight | 226.47 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 5-chloro-1-hydroxy-7-propoxy-3H-2,1-benzoxaborole |
| SMILES | CCCOc1cc(Cl)cc2c1B(O)OC2 |
| InChI | InChI=1S/C10H12BClO3/c1-2-3-14-9-5-8(12)4-7-6-15-11(13)10(7)9/h4-5,13H,2-3,6H2,1H3 |
| InChIKey | AUUFYJAXHBLKPA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|