C9H11BO2 — CID 130120936
1-hydroxy-5,7-dimethyl-3H-2,1-benzoxaborole (PubChem CID 130120936) has the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. Its IUPAC name is 1-hydroxy-5,7-dimethyl-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-5,7-dimethyl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 130120936 |
| Molecular Formula | C9H11BO2 |
| Molecular Weight | 162.00 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-hydroxy-5,7-dimethyl-3H-2,1-benzoxaborole |
| SMILES | Cc1cc(C)c2c(c1)COB2O |
| InChI | InChI=1S/C9H11BO2/c1-6-3-7(2)9-8(4-6)5-12-10(9)11/h3-4,11H,5H2,1-2H3 |
| InChIKey | QUIWTMOPLLJWTF-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.00 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|