About (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol
(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol (PubChem CID 24966978) has the molecular formula C8H9BO3
and a molecular weight of 163.97 g/mol. Its IUPAC name is (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol.
Molecular Properties
| Compound Name | (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol |
| PubChem CID | 24966978 |
| Molecular Formula | C8H9BO3 |
| Molecular Weight | 163.97 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol |
| SMILES | OCc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C8H9BO3/c10-4-6-2-1-3-7-5-12-9(11)8(6)7/h1-3,10-11H,4-5H2 |
| InChIKey | MPDQGMVOZYTKKO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.97 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol?
The IUPAC name of (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol (CID 24966978) is (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol.
What is the SMILES notation for (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol?
The canonical SMILES for (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol is OCc1cccc2c1B(O)OC2.
What is the InChIKey of (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol?
The InChIKey is MPDQGMVOZYTKKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO3/c10-4-6-2-1-3-7-5-12-9(11)8(6)7/h1-3,10-11H,4-5H2.
What are the key properties of (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol?
(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol has a molecular weight of 163.97 g/mol, XLogP of -0.60, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-3H-2,1-benzoxaborol-7-yl)methanol is sourced from PubChem (CID 24966978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).