C10H13BO2 — CID 155572832
1-hydroxy-6,8-dimethyl-3,4-dihydro-2,1-benzoxaborinine (PubChem CID 155572832) has the molecular formula C10H13BO2 and a molecular weight of 176.02 g/mol. Its IUPAC name is 1-hydroxy-6,8-dimethyl-3,4-dihydro-2,1-benzoxaborinine.
| Compound Name | 1-hydroxy-6,8-dimethyl-3,4-dihydro-2,1-benzoxaborinine |
|---|---|
| PubChem CID | 155572832 |
| Molecular Formula | C10H13BO2 |
| Molecular Weight | 176.02 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 1-hydroxy-6,8-dimethyl-3,4-dihydro-2,1-benzoxaborinine |
| SMILES | Cc1cc(C)c2c(c1)CCOB2O |
| InChI | InChI=1S/C10H13BO2/c1-7-5-8(2)10-9(6-7)3-4-13-11(10)12/h5-6,12H,3-4H2,1-2H3 |
| InChIKey | JIMCQHNISDNKPT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.02 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|