C16H15BN2O3 — CID 58079907
2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-3,6-dimethylpyridine (PubChem CID 58079907) has the molecular formula C16H15BN2O3 and a molecular weight of 294.12 g/mol. Its IUPAC name is 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-3,6-dimethylpyridine.
| Compound Name | 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-3,6-dimethylpyridine |
|---|---|
| PubChem CID | 58079907 |
| Molecular Formula | C16H15BN2O3 |
| Molecular Weight | 294.12 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborol-5-yl)oxy]-5-isocyano-3,6-dimethylpyridine |
| SMILES | [C-]#[N+]c1cc(C)c(Oc2cc(C)c3c(c2)COB3O)nc1C |
| InChI | InChI=1S/C16H15BN2O3/c1-9-5-13(7-12-8-21-17(20)15(9)12)22-16-10(2)6-14(18-4)11(3)19-16/h5-7,20H,8H2,1-3H3 |
| InChIKey | HZQKOYWTVMIYMH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|