C30H25B2N3O5 — CID 158664119
6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-3-isocyano-2-methylpyridine;1-hydroxy-5-(4-isocyano-3-methylphenoxy)-2,3-dihydro-1-benzoborole (PubChem CID 158664119) has the molecular formula C30H25B2N3O5 and a molecular weight of 529.17 g/mol. Its IUPAC name is 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-3-isocyano-2-methylpyridine;1-hydroxy-5-(4-isocyano-3-methylphenoxy)-2,3-dihydro-1-benzoborole.
| Compound Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-3-isocyano-2-methylpyridine;1-hydroxy-5-(4-isocyano-3-methylphenoxy)-2,3-dihydro-1-benzoborole |
|---|---|
| PubChem CID | 158664119 |
| Molecular Formula | C30H25B2N3O5 |
| Molecular Weight | 529.17 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 6-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-3-isocyano-2-methylpyridine;1-hydroxy-5-(4-isocyano-3-methylphenoxy)-2,3-dihydro-1-benzoborole |
| SMILES | [C-]#[N+]c1ccc(Oc2ccc3c(c2)CCB3O)cc1C.[C-]#[N+]c1ccc(Oc2ccc3c(c2)COB3O)nc1C |
| InChI | InChI=1S/C16H14BNO2.C14H11BN2O3/c1-11-9-13(4-6-16(11)18-2)20-14-3-5-15-12(10-14)7-8-17(15)19;1-9-13(16-2)5-6-14(17-9)20-11-3-4-12-10(7-11)8-19-15(12)18/h3-6,9-10,19H,7-8H2,1H3;3-7,18H,8H2,1H3 |
| InChIKey | IDDDYWCOWOXVEG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.17 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|