C12H10BNO3 — CID 71279066
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]pyridine (PubChem CID 71279066) has the molecular formula C12H10BNO3 and a molecular weight of 227.03 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]pyridine.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]pyridine |
|---|---|
| PubChem CID | 71279066 |
| Molecular Formula | C12H10BNO3 |
| Molecular Weight | 227.03 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]pyridine |
| SMILES | OB1OCc2cc(Oc3ccccn3)ccc21 |
| InChI | InChI=1S/C12H10BNO3/c15-13-11-5-4-10(7-9(11)8-16-13)17-12-3-1-2-6-14-12/h1-7,15H,8H2 |
| InChIKey | SWXDRLUNPOQAMJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.03 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|