About 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine
2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine (PubChem CID 143895389) has the molecular formula C12H9BINO3
and a molecular weight of 352.92 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine.
Molecular Properties
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine |
| PubChem CID | 143895389 |
| Molecular Formula | C12H9BINO3 |
| Molecular Weight | 352.92 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine |
| SMILES | OB1OCc2ccc(Oc3ccc(I)cn3)cc21 |
| InChI | InChI=1S/C12H9BINO3/c14-9-2-4-12(15-6-9)18-10-3-1-8-7-17-13(16)11(8)5-10/h1-6,16H,7H2 |
| InChIKey | GEMBAHZLENADER-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.92 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine?
The IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine (CID 143895389) is 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine.
What is the SMILES notation for 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine?
The canonical SMILES for 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine is OB1OCc2ccc(Oc3ccc(I)cn3)cc21.
What is the InChIKey of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine?
The InChIKey is GEMBAHZLENADER-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BINO3/c14-9-2-4-12(15-6-9)18-10-3-1-8-7-17-13(16)11(8)5-10/h1-6,16H,7H2.
What are the key properties of 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine?
2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine has a molecular weight of 352.92 g/mol, XLogP of 1.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-iodopyridine is sourced from PubChem (CID 143895389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).