C11H10BNO3S — CID 143895381
2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-methyl-1,3-thiazole (PubChem CID 143895381) has the molecular formula C11H10BNO3S and a molecular weight of 247.08 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-methyl-1,3-thiazole.
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 143895381 |
| Molecular Formula | C11H10BNO3S |
| Molecular Weight | 247.08 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-methyl-1,3-thiazole |
| SMILES | Cc1cnc(Oc2ccc3c(c2)B(O)OC3)s1 |
| InChI | InChI=1S/C11H10BNO3S/c1-7-5-13-11(17-7)16-9-3-2-8-6-15-12(14)10(8)4-9/h2-5,14H,6H2,1H3 |
| InChIKey | BBFQCWVOVKRLMH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.08 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|