C12H7BClF3N2O3 — CID 162617849
4-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-(trifluoromethyl)pyrimidine (PubChem CID 162617849) has the molecular formula C12H7BClF3N2O3 and a molecular weight of 330.46 g/mol. Its IUPAC name is 4-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-(trifluoromethyl)pyrimidine.
| Compound Name | 4-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 162617849 |
| Molecular Formula | C12H7BClF3N2O3 |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 4-chloro-2-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]-5-(trifluoromethyl)pyrimidine |
| SMILES | OB1OCc2ccc(Oc3ncc(C(F)(F)F)c(Cl)n3)cc21 |
| InChI | InChI=1S/C12H7BClF3N2O3/c14-10-8(12(15,16)17)4-18-11(19-10)22-7-2-1-6-5-21-13(20)9(6)3-7/h1-4,20H,5H2 |
| InChIKey | DZNOXLGYAWGVAR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|