C16H16BN3O4 — CID 122178913
2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 122178913) has the molecular formula C16H16BN3O4 and a molecular weight of 325.13 g/mol. Its IUPAC name is 2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 122178913 |
| Molecular Formula | C16H16BN3O4 |
| Molecular Weight | 325.13 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2-[5-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]pyrazin-2-yl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cnc(Oc3ccc4c(c3)B(O)OC4)cn2)=N1 |
| InChI | InChI=1S/C16H16BN3O4/c1-16(2)9-22-15(20-16)13-6-19-14(7-18-13)24-11-4-3-10-8-23-17(21)12(10)5-11/h3-7,21H,8-9H2,1-2H3 |
| InChIKey | ZPJDBFBQWGXHOM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|