C16H19B2FO6 — CID 158787736
deuterio(fluoro)methane;1-hydroxy-3H-2,1-benzoxaborol-6-ol;1-hydroxy-6-methoxy-3H-2,1-benzoxaborole (PubChem CID 158787736) has the molecular formula C16H19B2FO6 and a molecular weight of 348.95 g/mol. Its IUPAC name is deuterio(fluoro)methane;1-hydroxy-3H-2,1-benzoxaborol-6-ol;1-hydroxy-6-methoxy-3H-2,1-benzoxaborole.
| Compound Name | deuterio(fluoro)methane;1-hydroxy-3H-2,1-benzoxaborol-6-ol;1-hydroxy-6-methoxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 158787736 |
| Molecular Formula | C16H19B2FO6 |
| Molecular Weight | 348.95 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | deuterio(fluoro)methane;1-hydroxy-3H-2,1-benzoxaborol-6-ol;1-hydroxy-6-methoxy-3H-2,1-benzoxaborole |
| SMILES | COc1ccc2c(c1)B(O)OC2.OB1OCc2ccc(O)cc21.[2H]CF |
| InChI | InChI=1S/C8H9BO3.C7H7BO3.CH3F/c1-11-7-3-2-6-5-12-9(10)8(6)4-7;9-6-2-1-5-4-11-8(10)7(5)3-6;1-2/h2-4,10H,5H2,1H3;1-3,9-10H,4H2;1H3/i;;1D |
| InChIKey | IRWXVWAXIJVRPW-PRQZKWGPSA-N |
| XLogP | 0.11 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.95 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|