About 2-bromo-4-methoxyphenol;deuterio(fluoro)methane
2-bromo-4-methoxyphenol;deuterio(fluoro)methane (PubChem CID 158022757) has the molecular formula C8H10BrFO2
and a molecular weight of 238.07 g/mol. Its IUPAC name is 2-bromo-4-methoxyphenol;deuterio(fluoro)methane.
Molecular Properties
| Compound Name | 2-bromo-4-methoxyphenol;deuterio(fluoro)methane |
| PubChem CID | 158022757 |
| Molecular Formula | C8H10BrFO2 |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 2-bromo-4-methoxyphenol;deuterio(fluoro)methane |
| SMILES | COc1ccc(O)c(Br)c1.[2H]CF |
| InChI | InChI=1S/C7H7BrO2.CH3F/c1-10-5-2-3-7(9)6(8)4-5;1-2/h2-4,9H,1H3;1H3/i;1D |
| InChIKey | FGGDTAPZHJSRQW-DIYDOPDJSA-N |
| XLogP | 2.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-4-methoxyphenol;deuterio(fluoro)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methoxyphenol;deuterio(fluoro)methane?
The IUPAC name of 2-bromo-4-methoxyphenol;deuterio(fluoro)methane (CID 158022757) is 2-bromo-4-methoxyphenol;deuterio(fluoro)methane.
What is the SMILES notation for 2-bromo-4-methoxyphenol;deuterio(fluoro)methane?
The canonical SMILES for 2-bromo-4-methoxyphenol;deuterio(fluoro)methane is COc1ccc(O)c(Br)c1.[2H]CF.
What is the InChIKey of 2-bromo-4-methoxyphenol;deuterio(fluoro)methane?
The InChIKey is FGGDTAPZHJSRQW-DIYDOPDJSA-N. The full InChI is InChI=1S/C7H7BrO2.CH3F/c1-10-5-2-3-7(9)6(8)4-5;1-2/h2-4,9H,1H3;1H3/i;1D.
What are the key properties of 2-bromo-4-methoxyphenol;deuterio(fluoro)methane?
2-bromo-4-methoxyphenol;deuterio(fluoro)methane has a molecular weight of 238.07 g/mol, XLogP of 2.75, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methoxyphenol;deuterio(fluoro)methane is sourced from PubChem (CID 158022757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).