C15H14BrF2NO2 — CID 107609953
2-[1-(4-bromo-2,5-difluoroanilino)ethyl]-4-methoxyphenol (PubChem CID 107609953) has the molecular formula C15H14BrF2NO2 and a molecular weight of 358.18 g/mol. Its IUPAC name is 2-[1-(4-bromo-2,5-difluoroanilino)ethyl]-4-methoxyphenol.
| Compound Name | 2-[1-(4-bromo-2,5-difluoroanilino)ethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 107609953 |
| Molecular Formula | C15H14BrF2NO2 |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2-[1-(4-bromo-2,5-difluoroanilino)ethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C(C)Nc2cc(F)c(Br)cc2F)c1 |
| InChI | InChI=1S/C15H14BrF2NO2/c1-8(10-5-9(21-2)3-4-15(10)20)19-14-7-12(17)11(16)6-13(14)18/h3-8,19-20H,1-2H3 |
| InChIKey | DXTYSGJGTYBXMK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|