C15H14BrF2NO — CID 102852847
2-[1-(5-bromo-2,4-difluoroanilino)ethyl]-4-methylphenol (PubChem CID 102852847) has the molecular formula C15H14BrF2NO and a molecular weight of 342.18 g/mol. Its IUPAC name is 2-[1-(5-bromo-2,4-difluoroanilino)ethyl]-4-methylphenol.
| Compound Name | 2-[1-(5-bromo-2,4-difluoroanilino)ethyl]-4-methylphenol |
|---|---|
| PubChem CID | 102852847 |
| Molecular Formula | C15H14BrF2NO |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2-[1-(5-bromo-2,4-difluoroanilino)ethyl]-4-methylphenol |
| SMILES | Cc1ccc(O)c(C(C)Nc2cc(Br)c(F)cc2F)c1 |
| InChI | InChI=1S/C15H14BrF2NO/c1-8-3-4-15(20)10(5-8)9(2)19-14-6-11(16)12(17)7-13(14)18/h3-7,9,19-20H,1-2H3 |
| InChIKey | IJEIPCMNQHLKIC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|