C15H15Br2NO2 — CID 107597660
2-[1-(2,6-dibromoanilino)ethyl]-4-methoxyphenol (PubChem CID 107597660) has the molecular formula C15H15Br2NO2 and a molecular weight of 401.10 g/mol. Its IUPAC name is 2-[1-(2,6-dibromoanilino)ethyl]-4-methoxyphenol.
| Compound Name | 2-[1-(2,6-dibromoanilino)ethyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 107597660 |
| Molecular Formula | C15H15Br2NO2 |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 2-[1-(2,6-dibromoanilino)ethyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C(C)Nc2c(Br)cccc2Br)c1 |
| InChI | InChI=1S/C15H15Br2NO2/c1-9(11-8-10(20-2)6-7-14(11)19)18-15-12(16)4-3-5-13(15)17/h3-9,18-19H,1-2H3 |
| InChIKey | DXWLKHPJMOLSSM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|