C11H14F3NO3 — CID 82712637
4-methoxy-2-[1-(2,2,2-trifluoroethoxyamino)ethyl]phenol (PubChem CID 82712637) has the molecular formula C11H14F3NO3 and a molecular weight of 265.23 g/mol. Its IUPAC name is 4-methoxy-2-[1-(2,2,2-trifluoroethoxyamino)ethyl]phenol.
| Compound Name | 4-methoxy-2-[1-(2,2,2-trifluoroethoxyamino)ethyl]phenol |
|---|---|
| PubChem CID | 82712637 |
| Molecular Formula | C11H14F3NO3 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-methoxy-2-[1-(2,2,2-trifluoroethoxyamino)ethyl]phenol |
| SMILES | COc1ccc(O)c(C(C)NOCC(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F3NO3/c1-7(15-18-6-11(12,13)14)9-5-8(17-2)3-4-10(9)16/h3-5,7,15-16H,6H2,1-2H3 |
| InChIKey | NGLJEHSEUGQESK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|