C16H18BrNO3 — CID 61167159
2-[1-[3-bromo-2-(methoxymethyl)anilino]ethyl]benzene-1,4-diol (PubChem CID 61167159) has the molecular formula C16H18BrNO3 and a molecular weight of 352.23 g/mol. Its IUPAC name is 2-[1-[3-bromo-2-(methoxymethyl)anilino]ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-[3-bromo-2-(methoxymethyl)anilino]ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 61167159 |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2-[1-[3-bromo-2-(methoxymethyl)anilino]ethyl]benzene-1,4-diol |
| SMILES | COCc1c(Br)cccc1NC(C)c1cc(O)ccc1O |
| InChI | InChI=1S/C16H18BrNO3/c1-10(12-8-11(19)6-7-16(12)20)18-15-5-3-4-14(17)13(15)9-21-2/h3-8,10,18-20H,9H2,1-2H3 |
| InChIKey | XQRIRYJMQDYOAW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|