C30H36B2N2O6 — CID 159129382
ethanamine;1-hydroxy-5-phenoxy-3H-2,1-benzoxaborole;1-hydroxy-6-phenoxy-3H-2,1-benzoxaborole (PubChem CID 159129382) has the molecular formula C30H36B2N2O6 and a molecular weight of 542.25 g/mol. Its IUPAC name is ethanamine;1-hydroxy-5-phenoxy-3H-2,1-benzoxaborole;1-hydroxy-6-phenoxy-3H-2,1-benzoxaborole.
| Compound Name | ethanamine;1-hydroxy-5-phenoxy-3H-2,1-benzoxaborole;1-hydroxy-6-phenoxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 159129382 |
| Molecular Formula | C30H36B2N2O6 |
| Molecular Weight | 542.25 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | ethanamine;1-hydroxy-5-phenoxy-3H-2,1-benzoxaborole;1-hydroxy-6-phenoxy-3H-2,1-benzoxaborole |
| SMILES | CCN.CCN.OB1OCc2cc(Oc3ccccc3)ccc21.OB1OCc2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/2C13H11BO3.2C2H7N/c15-14-13-7-6-12(8-10(13)9-16-14)17-11-4-2-1-3-5-11;15-14-13-8-12(7-6-10(13)9-16-14)17-11-4-2-1-3-5-11;2*1-2-3/h2*1-8,15H,9H2;2*2-3H2,1H3 |
| InChIKey | KGRLXIYSZYSLSA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|