C20H31BO2 — CID 157341473
ethane;1-methyl-5-phenoxy-3H-2,1-benzoxaborole (PubChem CID 157341473) has the molecular formula C20H31BO2 and a molecular weight of 314.28 g/mol. Its IUPAC name is ethane;1-methyl-5-phenoxy-3H-2,1-benzoxaborole.
| Compound Name | ethane;1-methyl-5-phenoxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 157341473 |
| Molecular Formula | C20H31BO2 |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | ethane;1-methyl-5-phenoxy-3H-2,1-benzoxaborole |
| SMILES | CB1OCc2cc(Oc3ccccc3)ccc21.CC.CC.CC |
| InChI | InChI=1S/C14H13BO2.3C2H6/c1-15-14-8-7-13(9-11(14)10-16-15)17-12-5-3-2-4-6-12;3*1-2/h2-9H,10H2,1H3;3*1-2H3 |
| InChIKey | BGLHNUHKQFLGAX-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|