About ethane;1-methyl-3H-2,1-benzoxaborole
ethane;1-methyl-3H-2,1-benzoxaborole (PubChem CID 158197339) has the molecular formula C10H15BO
and a molecular weight of 162.04 g/mol. Its IUPAC name is ethane;1-methyl-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | ethane;1-methyl-3H-2,1-benzoxaborole |
| PubChem CID | 158197339 |
| Molecular Formula | C10H15BO |
| Molecular Weight | 162.04 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | ethane;1-methyl-3H-2,1-benzoxaborole |
| SMILES | CB1OCc2ccccc21.CC |
| InChI | InChI=1S/C8H9BO.C2H6/c1-9-8-5-3-2-4-7(8)6-10-9;1-2/h2-5H,6H2,1H3;1-2H3 |
| InChIKey | GAMOVIIKKNXYEN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.04 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-3H-2,1-benzoxaborole?
The IUPAC name of ethane;1-methyl-3H-2,1-benzoxaborole (CID 158197339) is ethane;1-methyl-3H-2,1-benzoxaborole.
What is the SMILES notation for ethane;1-methyl-3H-2,1-benzoxaborole?
The canonical SMILES for ethane;1-methyl-3H-2,1-benzoxaborole is CB1OCc2ccccc21.CC.
What is the InChIKey of ethane;1-methyl-3H-2,1-benzoxaborole?
The InChIKey is GAMOVIIKKNXYEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BO.C2H6/c1-9-8-5-3-2-4-7(8)6-10-9;1-2/h2-5H,6H2,1H3;1-2H3.
What are the key properties of ethane;1-methyl-3H-2,1-benzoxaborole?
ethane;1-methyl-3H-2,1-benzoxaborole has a molecular weight of 162.04 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-3H-2,1-benzoxaborole is sourced from PubChem (CID 158197339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).