C17H14BNO3 — CID 167596796
2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)methyl]isoindole-1,3-dione (PubChem CID 167596796) has the molecular formula C17H14BNO3 and a molecular weight of 291.12 g/mol. Its IUPAC name is 2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167596796 |
| Molecular Formula | C17H14BNO3 |
| Molecular Weight | 291.12 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)methyl]isoindole-1,3-dione |
| SMILES | CB1OCc2ccc(CN3C(=O)c4ccccc4C3=O)cc21 |
| InChI | InChI=1S/C17H14BNO3/c1-18-15-8-11(6-7-12(15)10-22-18)9-19-16(20)13-4-2-3-5-14(13)17(19)21/h2-8H,9-10H2,1H3 |
| InChIKey | KPBQXBDMGMENER-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|