C7H8BO2+ — CID 149257702
3H-2,1-benzoxaborol-1-yloxidanium (PubChem CID 149257702) has the molecular formula C7H8BO2+ and a molecular weight of 134.95 g/mol. Its IUPAC name is 3H-2,1-benzoxaborol-1-yloxidanium.
| Compound Name | 3H-2,1-benzoxaborol-1-yloxidanium |
|---|---|
| PubChem CID | 149257702 |
| Molecular Formula | C7H8BO2+ |
| Molecular Weight | 134.95 g/mol |
| Exact Mass | 135.06 |
| IUPAC Name | 3H-2,1-benzoxaborol-1-yloxidanium |
| SMILES | [OH2+]B1OCc2ccccc21 |
| InChI | InChI=1S/C7H7BO2/c9-8-7-4-2-1-3-6(7)5-10-8/h1-4,9H,5H2/p+1 |
| InChIKey | XOQABDOICLHPIS-UHFFFAOYSA-O |
| XLogP | -0.36 |
| TPSA | 32.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.95 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|