C13H10BClO2 — CID 59855523
2-(3H-2,1-benzoxaborol-1-yl)-5-chlorophenol (PubChem CID 59855523) has the molecular formula C13H10BClO2 and a molecular weight of 244.49 g/mol. Its IUPAC name is 2-(3H-2,1-benzoxaborol-1-yl)-5-chlorophenol.
| Compound Name | 2-(3H-2,1-benzoxaborol-1-yl)-5-chlorophenol |
|---|---|
| PubChem CID | 59855523 |
| Molecular Formula | C13H10BClO2 |
| Molecular Weight | 244.49 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 2-(3H-2,1-benzoxaborol-1-yl)-5-chlorophenol |
| SMILES | Oc1cc(Cl)ccc1B1OCc2ccccc21 |
| InChI | InChI=1S/C13H10BClO2/c15-10-5-6-12(13(16)7-10)14-11-4-2-1-3-9(11)8-17-14/h1-7,16H,8H2 |
| InChIKey | NVBWBUHCBPUPLF-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|