C15H10BFOS — CID 59008805
1-(1-benzothiophen-3-yl)-5-fluoro-3H-2,1-benzoxaborole (PubChem CID 59008805) has the molecular formula C15H10BFOS and a molecular weight of 268.12 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-5-fluoro-3H-2,1-benzoxaborole.
| Compound Name | 1-(1-benzothiophen-3-yl)-5-fluoro-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 59008805 |
| Molecular Formula | C15H10BFOS |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-5-fluoro-3H-2,1-benzoxaborole |
| SMILES | Fc1ccc2c(c1)COB2c1csc2ccccc12 |
| InChI | InChI=1S/C15H10BFOS/c17-11-5-6-13-10(7-11)8-18-16(13)14-9-19-15-4-2-1-3-12(14)15/h1-7,9H,8H2 |
| InChIKey | MJIZIALOURQFKM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|