About 3-methyl-1-benzothiophene;zinc
3-methyl-1-benzothiophene;zinc (PubChem CID 70563074) has the molecular formula C9H8SZn
and a molecular weight of 213.62 g/mol. Its IUPAC name is 3-methyl-1-benzothiophene;zinc.
Molecular Properties
| Compound Name | 3-methyl-1-benzothiophene;zinc |
| PubChem CID | 70563074 |
| Molecular Formula | C9H8SZn |
| Molecular Weight | 213.62 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | 3-methyl-1-benzothiophene;zinc |
| SMILES | Cc1csc2ccccc12.[Zn] |
| InChI | InChI=1S/C9H8S.Zn/c1-7-6-10-9-5-3-2-4-8(7)9;/h2-6H,1H3; |
| InChIKey | OFAZPVAFYHSYQI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.62 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-benzothiophene;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-benzothiophene;zinc?
The IUPAC name of 3-methyl-1-benzothiophene;zinc (CID 70563074) is 3-methyl-1-benzothiophene;zinc.
What is the SMILES notation for 3-methyl-1-benzothiophene;zinc?
The canonical SMILES for 3-methyl-1-benzothiophene;zinc is Cc1csc2ccccc12.[Zn].
What is the InChIKey of 3-methyl-1-benzothiophene;zinc?
The InChIKey is OFAZPVAFYHSYQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8S.Zn/c1-7-6-10-9-5-3-2-4-8(7)9;/h2-6H,1H3;.
What are the key properties of 3-methyl-1-benzothiophene;zinc?
3-methyl-1-benzothiophene;zinc has a molecular weight of 213.62 g/mol, XLogP of 3.21, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-benzothiophene;zinc is sourced from PubChem (CID 70563074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).