About ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene)
ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) (PubChem CID 142901816) has the molecular formula C30H32S3
and a molecular weight of 488.79 g/mol. Its IUPAC name is ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene).
Molecular Properties
| Compound Name | ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) |
| PubChem CID | 142901816 |
| Molecular Formula | C30H32S3 |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) |
| SMILES | CC.CCc1csc2ccccc12.Cc1csc2ccccc12.Cc1csc2ccccc12 |
| InChI | InChI=1S/C10H10S.2C9H8S.C2H6/c1-2-8-7-11-10-6-4-3-5-9(8)10;2*1-7-6-10-9-5-3-2-4-8(7)9;1-2/h3-7H,2H2,1H3;2*2-6H,1H3;1-2H3 |
| InChIKey | VLASPPVGGVEQOP-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene)?
The IUPAC name of ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) (CID 142901816) is ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene).
What is the SMILES notation for ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene)?
The canonical SMILES for ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) is CC.CCc1csc2ccccc12.Cc1csc2ccccc12.Cc1csc2ccccc12.
What is the InChIKey of ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene)?
The InChIKey is VLASPPVGGVEQOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10S.2C9H8S.C2H6/c1-2-8-7-11-10-6-4-3-5-9(8)10;2*1-7-6-10-9-5-3-2-4-8(7)9;1-2/h3-7H,2H2,1H3;2*2-6H,1H3;1-2H3.
What are the key properties of ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene)?
ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) has a molecular weight of 488.79 g/mol, XLogP of 10.91, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-1-benzothiophene;bis(3-methyl-1-benzothiophene) is sourced from PubChem (CID 142901816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).