C18H18OS — CID 65150146
2-(1-benzothiophen-3-yl)-1-(2-ethylphenyl)ethanol (PubChem CID 65150146) has the molecular formula C18H18OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(2-ethylphenyl)ethanol.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(2-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 65150146 |
| Molecular Formula | C18H18OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(2-ethylphenyl)ethanol |
| SMILES | CCc1ccccc1C(O)Cc1csc2ccccc12 |
| InChI | InChI=1S/C18H18OS/c1-2-13-7-3-4-8-15(13)17(19)11-14-12-20-18-10-6-5-9-16(14)18/h3-10,12,17,19H,2,11H2,1H3 |
| InChIKey | IUTUJSOQOLAXRG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |