C11H8BFO2 — CID 11845746
5-fluoro-1-(furan-3-yl)-3H-2,1-benzoxaborole (PubChem CID 11845746) has the molecular formula C11H8BFO2 and a molecular weight of 201.99 g/mol. Its IUPAC name is 5-fluoro-1-(furan-3-yl)-3H-2,1-benzoxaborole.
| Compound Name | 5-fluoro-1-(furan-3-yl)-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 11845746 |
| Molecular Formula | C11H8BFO2 |
| Molecular Weight | 201.99 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 5-fluoro-1-(furan-3-yl)-3H-2,1-benzoxaborole |
| SMILES | Fc1ccc2c(c1)COB2c1ccoc1 |
| InChI | InChI=1S/C11H8BFO2/c13-10-1-2-11-8(5-10)6-15-12(11)9-3-4-14-7-9/h1-5,7H,6H2 |
| InChIKey | FFGFXTUHVJRIFJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.99 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|