C11H14BFO2 — CID 90324234
1-butoxy-5-fluoro-3H-2,1-benzoxaborole (PubChem CID 90324234) has the molecular formula C11H14BFO2 and a molecular weight of 208.04 g/mol. Its IUPAC name is 1-butoxy-5-fluoro-3H-2,1-benzoxaborole.
| Compound Name | 1-butoxy-5-fluoro-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 90324234 |
| Molecular Formula | C11H14BFO2 |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 1-butoxy-5-fluoro-3H-2,1-benzoxaborole |
| SMILES | CCCCOB1OCc2cc(F)ccc21 |
| InChI | InChI=1S/C11H14BFO2/c1-2-3-6-14-12-11-5-4-10(13)7-9(11)8-15-12/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | ZOTZKLWUFYIVJI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|