About 1-decoxy-3H-2,1-benzoxaborole
1-decoxy-3H-2,1-benzoxaborole (PubChem CID 142602018) has the molecular formula C17H27BO2
and a molecular weight of 274.21 g/mol. Its IUPAC name is 1-decoxy-3H-2,1-benzoxaborole.
Molecular Properties
| Compound Name | 1-decoxy-3H-2,1-benzoxaborole |
| PubChem CID | 142602018 |
| Molecular Formula | C17H27BO2 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 1-decoxy-3H-2,1-benzoxaborole |
| SMILES | CCCCCCCCCCOB1OCc2ccccc21 |
| InChI | InChI=1S/C17H27BO2/c1-2-3-4-5-6-7-8-11-14-19-18-17-13-10-9-12-16(17)15-20-18/h9-10,12-13H,2-8,11,14-15H2,1H3 |
| InChIKey | WXABICKOBHCXSI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-decoxy-3H-2,1-benzoxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-decoxy-3H-2,1-benzoxaborole?
The IUPAC name of 1-decoxy-3H-2,1-benzoxaborole (CID 142602018) is 1-decoxy-3H-2,1-benzoxaborole.
What is the SMILES notation for 1-decoxy-3H-2,1-benzoxaborole?
The canonical SMILES for 1-decoxy-3H-2,1-benzoxaborole is CCCCCCCCCCOB1OCc2ccccc21.
What is the InChIKey of 1-decoxy-3H-2,1-benzoxaborole?
The InChIKey is WXABICKOBHCXSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27BO2/c1-2-3-4-5-6-7-8-11-14-19-18-17-13-10-9-12-16(17)15-20-18/h9-10,12-13H,2-8,11,14-15H2,1H3.
What are the key properties of 1-decoxy-3H-2,1-benzoxaborole?
1-decoxy-3H-2,1-benzoxaborole has a molecular weight of 274.21 g/mol, XLogP of 4.07, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-decoxy-3H-2,1-benzoxaborole is sourced from PubChem (CID 142602018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).