C17H27BO2 — CID 142602018
1-decoxy-3H-2,1-benzoxaborole (PubChem CID 142602018) has the molecular formula C17H27BO2 and a molecular weight of 274.21 g/mol. Its IUPAC name is 1-decoxy-3H-2,1-benzoxaborole.
| Compound Name | 1-decoxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 142602018 |
| Molecular Formula | C17H27BO2 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.21 |
| IUPAC Name | 1-decoxy-3H-2,1-benzoxaborole |
| SMILES | CCCCCCCCCCOB1OCc2ccccc21 |
| InChI | InChI=1S/C17H27BO2/c1-2-3-4-5-6-7-8-11-14-19-18-17-13-10-9-12-16(17)15-20-18/h9-10,12-13H,2-8,11,14-15H2,1H3 |
| InChIKey | WXABICKOBHCXSI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|