C17H19BO — CID 59008768
1-(2,6-diethylphenyl)-3H-2,1-benzoxaborole (PubChem CID 59008768) has the molecular formula C17H19BO and a molecular weight of 250.15 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3H-2,1-benzoxaborole.
| Compound Name | 1-(2,6-diethylphenyl)-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 59008768 |
| Molecular Formula | C17H19BO |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3H-2,1-benzoxaborole |
| SMILES | CCc1cccc(CC)c1B1OCc2ccccc21 |
| InChI | InChI=1S/C17H19BO/c1-3-13-9-7-10-14(4-2)17(13)18-16-11-6-5-8-15(16)12-19-18/h5-11H,3-4,12H2,1-2H3 |
| InChIKey | HLCRYUIYEVUKKF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|