C15H24BGaO2 — CID 177411629
3H-2,1-benzoxaborol-1-yloxy(ditert-butyl)gallane (PubChem CID 177411629) has the molecular formula C15H24BGaO2 and a molecular weight of 316.89 g/mol. Its IUPAC name is 3H-2,1-benzoxaborol-1-yloxy(ditert-butyl)gallane.
| Compound Name | 3H-2,1-benzoxaborol-1-yloxy(ditert-butyl)gallane |
|---|---|
| PubChem CID | 177411629 |
| Molecular Formula | C15H24BGaO2 |
| Molecular Weight | 316.89 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 3H-2,1-benzoxaborol-1-yloxy(ditert-butyl)gallane |
| SMILES | CC(C)(C)[Ga](OB1OCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C7H6BO2.2C4H9.Ga/c9-8-7-4-2-1-3-6(7)5-10-8;2*1-4(2)3;/h1-4H,5H2;2*1-3H3;/q-1;;;+1 |
| InChIKey | HJGFZSHFBQLXIL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|