C11H9BOS — CID 59008762
1-thiophen-3-yl-3H-2,1-benzoxaborole (PubChem CID 59008762) has the molecular formula C11H9BOS and a molecular weight of 200.07 g/mol. Its IUPAC name is 1-thiophen-3-yl-3H-2,1-benzoxaborole.
| Compound Name | 1-thiophen-3-yl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 59008762 |
| Molecular Formula | C11H9BOS |
| Molecular Weight | 200.07 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 1-thiophen-3-yl-3H-2,1-benzoxaborole |
| SMILES | c1ccc2c(c1)COB2c1ccsc1 |
| InChI | InChI=1S/C11H9BOS/c1-2-4-11-9(3-1)7-13-12(11)10-5-6-14-8-10/h1-6,8H,7H2 |
| InChIKey | AFDVCCNRLRCDBS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.07 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|