C14H8BF5O2 — CID 139243400
3-(2,3,4,5,6-pentafluorophenyl)-1,5-dihydro-2,4,3-benzodioxaborepine (PubChem CID 139243400) has the molecular formula C14H8BF5O2 and a molecular weight of 314.02 g/mol. Its IUPAC name is 3-(2,3,4,5,6-pentafluorophenyl)-1,5-dihydro-2,4,3-benzodioxaborepine.
| Compound Name | 3-(2,3,4,5,6-pentafluorophenyl)-1,5-dihydro-2,4,3-benzodioxaborepine |
|---|---|
| PubChem CID | 139243400 |
| Molecular Formula | C14H8BF5O2 |
| Molecular Weight | 314.02 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-(2,3,4,5,6-pentafluorophenyl)-1,5-dihydro-2,4,3-benzodioxaborepine |
| SMILES | Fc1c(F)c(F)c(B2OCc3ccccc3CO2)c(F)c1F |
| InChI | InChI=1S/C14H8BF5O2/c16-10-9(11(17)13(19)14(20)12(10)18)15-21-5-7-3-1-2-4-8(7)6-22-15/h1-4H,5-6H2 |
| InChIKey | PIOOURXYJCOXFL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|