C8H8O3P+ — CID 130387772
1,5-dihydro-2,4,3-benzodioxaphosphepin-3-ium 3-oxide (PubChem CID 130387772) has the molecular formula C8H8O3P+ and a molecular weight of 183.12 g/mol. Its IUPAC name is 1,5-dihydro-2,4,3-benzodioxaphosphepin-3-ium 3-oxide.
| Compound Name | 1,5-dihydro-2,4,3-benzodioxaphosphepin-3-ium 3-oxide |
|---|---|
| PubChem CID | 130387772 |
| Molecular Formula | C8H8O3P+ |
| Molecular Weight | 183.12 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 1,5-dihydro-2,4,3-benzodioxaphosphepin-3-ium 3-oxide |
| SMILES | O=[P+]1OCc2ccccc2CO1 |
| InChI | InChI=1S/C8H8O3P/c9-12-10-5-7-3-1-2-4-8(7)6-11-12/h1-4H,5-6H2/q+1 |
| InChIKey | XALSXBOMXFOQRG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.12 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|