C9H8O4P+ — CID 175749962
2-oxo-4-phenyl-1,3,2-dioxaphosphinan-2-ium-5-one (PubChem CID 175749962) has the molecular formula C9H8O4P+ and a molecular weight of 211.13 g/mol. Its IUPAC name is 2-oxo-4-phenyl-1,3,2-dioxaphosphinan-2-ium-5-one.
| Compound Name | 2-oxo-4-phenyl-1,3,2-dioxaphosphinan-2-ium-5-one |
|---|---|
| PubChem CID | 175749962 |
| Molecular Formula | C9H8O4P+ |
| Molecular Weight | 211.13 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 2-oxo-4-phenyl-1,3,2-dioxaphosphinan-2-ium-5-one |
| SMILES | O=C1CO[P+](=O)OC1c1ccccc1 |
| InChI | InChI=1S/C9H8O4P/c10-8-6-12-14(11)13-9(8)7-4-2-1-3-5-7/h1-5,9H,6H2/q+1 |
| InChIKey | MCISREYVMNWDPK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.13 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|