C16H14O3 — CID 102069658
(2R,5R)-2-methyl-2,5-diphenyl-1,3-dioxolan-4-one (PubChem CID 102069658) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2R,5R)-2-methyl-2,5-diphenyl-1,3-dioxolan-4-one.
| Compound Name | (2R,5R)-2-methyl-2,5-diphenyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 102069658 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (2R,5R)-2-methyl-2,5-diphenyl-1,3-dioxolan-4-one |
| SMILES | C[C@]1(c2ccccc2)OC(=O)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H14O3/c1-16(13-10-6-3-7-11-13)18-14(15(17)19-16)12-8-4-2-5-9-12/h2-11,14H,1H3/t14-,16-/m1/s1 |
| InChIKey | QCRFXTDPKONTGQ-GDBMZVCRSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |