C16H12O4 — CID 101432935
(3R,6R)-3,6-diphenyl-1,4-dioxane-2,5-dione (PubChem CID 101432935) has the molecular formula C16H12O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is (3R,6R)-3,6-diphenyl-1,4-dioxane-2,5-dione.
| Compound Name | (3R,6R)-3,6-diphenyl-1,4-dioxane-2,5-dione |
|---|---|
| PubChem CID | 101432935 |
| Molecular Formula | C16H12O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (3R,6R)-3,6-diphenyl-1,4-dioxane-2,5-dione |
| SMILES | O=C1O[C@H](c2ccccc2)C(=O)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H12O4/c17-15-13(11-7-3-1-4-8-11)19-16(18)14(20-15)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14-/m1/s1 |
| InChIKey | NJEHRDMPAXVGIL-ZIAGYGMSSA-N |
| XLogP | 2.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |