C9H7FO2S — CID 10750460
(2S,4R)-4-fluoro-2-phenyl-1,3-oxathiolan-5-one (PubChem CID 10750460) has the molecular formula C9H7FO2S and a molecular weight of 198.22 g/mol. Its IUPAC name is (2S,4R)-4-fluoro-2-phenyl-1,3-oxathiolan-5-one.
| Compound Name | (2S,4R)-4-fluoro-2-phenyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 10750460 |
| Molecular Formula | C9H7FO2S |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | (2S,4R)-4-fluoro-2-phenyl-1,3-oxathiolan-5-one |
| SMILES | O=C1O[C@H](c2ccccc2)S[C@H]1F |
| InChI | InChI=1S/C9H7FO2S/c10-7-8(11)12-9(13-7)6-4-2-1-3-5-6/h1-5,7,9H/t7-,9+/m1/s1 |
| InChIKey | GTFDDGGGXXSTQU-APPZFPTMSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |