C10H10O3S — CID 139899543
2-(2-hydroxyphenyl)-4-methyl-1,3-oxathiolan-5-one (PubChem CID 139899543) has the molecular formula C10H10O3S and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-4-methyl-1,3-oxathiolan-5-one.
| Compound Name | 2-(2-hydroxyphenyl)-4-methyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 139899543 |
| Molecular Formula | C10H10O3S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 2-(2-hydroxyphenyl)-4-methyl-1,3-oxathiolan-5-one |
| SMILES | CC1SC(c2ccccc2O)OC1=O |
| InChI | InChI=1S/C10H10O3S/c1-6-9(12)13-10(14-6)7-4-2-3-5-8(7)11/h2-6,10-11H,1H3 |
| InChIKey | FRHZHIJEVKZBAY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |