C11H12O3S — CID 139899567
2-(2-methoxyphenyl)-4-methyl-1,3-oxathiolan-5-one (PubChem CID 139899567) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-4-methyl-1,3-oxathiolan-5-one.
| Compound Name | 2-(2-methoxyphenyl)-4-methyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 139899567 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-(2-methoxyphenyl)-4-methyl-1,3-oxathiolan-5-one |
| SMILES | COc1ccccc1C1OC(=O)C(C)S1 |
| InChI | InChI=1S/C11H12O3S/c1-7-10(12)14-11(15-7)8-5-3-4-6-9(8)13-2/h3-7,11H,1-2H3 |
| InChIKey | YCPAZVCYWFBFGK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |