C7H6O2S — CID 141391281
4-phenyl-1,3,2-dioxathietane (PubChem CID 141391281) has the molecular formula C7H6O2S and a molecular weight of 154.19 g/mol. Its IUPAC name is 4-phenyl-1,3,2-dioxathietane.
| Compound Name | 4-phenyl-1,3,2-dioxathietane |
|---|---|
| PubChem CID | 141391281 |
| Molecular Formula | C7H6O2S |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.01 |
| IUPAC Name | 4-phenyl-1,3,2-dioxathietane |
| SMILES | c1ccc(C2OSO2)cc1 |
| InChI | InChI=1S/C7H6O2S/c1-2-4-6(5-3-1)7-8-10-9-7/h1-5,7H |
| InChIKey | MSUHCYLOOGOTMY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|