About 5-phenyltetraoxolane
5-phenyltetraoxolane (PubChem CID 102034769) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is 5-phenyltetraoxolane.
Molecular Properties
| Compound Name | 5-phenyltetraoxolane |
| PubChem CID | 102034769 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 5-phenyltetraoxolane |
| SMILES | c1ccc(C2OOOO2)cc1 |
| InChI | InChI=1S/C7H6O4/c1-2-4-6(5-3-1)7-8-10-11-9-7/h1-5,7H |
| InChIKey | YBFXHPBDPYVGOE-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-phenyltetraoxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyltetraoxolane?
The IUPAC name of 5-phenyltetraoxolane (CID 102034769) is 5-phenyltetraoxolane.
What is the SMILES notation for 5-phenyltetraoxolane?
The canonical SMILES for 5-phenyltetraoxolane is c1ccc(C2OOOO2)cc1.
What is the InChIKey of 5-phenyltetraoxolane?
The InChIKey is YBFXHPBDPYVGOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c1-2-4-6(5-3-1)7-8-10-11-9-7/h1-5,7H.
What are the key properties of 5-phenyltetraoxolane?
5-phenyltetraoxolane has a molecular weight of 154.12 g/mol, XLogP of 1.51, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyltetraoxolane is sourced from PubChem (CID 102034769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).